C21H35N3O2S2 — CID 122664152
S-[[2-[[(2S)-2,6-diaminohexanoyl]sulfanylmethyl]phenyl]methyl] (2S)-2-aminoheptanethioate (PubChem CID 122664152) has the molecular formula C21H35N3O2S2 and a molecular weight of 425.66 g/mol. Its IUPAC name is S-[[2-[[(2S)-2,6-diaminohexanoyl]sulfanylmethyl]phenyl]methyl] (2S)-2-aminoheptanethioate.
| Compound Name | S-[[2-[[(2S)-2,6-diaminohexanoyl]sulfanylmethyl]phenyl]methyl] (2S)-2-aminoheptanethioate |
|---|---|
| PubChem CID | 122664152 |
| Molecular Formula | C21H35N3O2S2 |
| Molecular Weight | 425.66 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | S-[[2-[[(2S)-2,6-diaminohexanoyl]sulfanylmethyl]phenyl]methyl] (2S)-2-aminoheptanethioate |
| SMILES | CCCCC[C@H](N)C(=O)SCc1ccccc1CSC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C21H35N3O2S2/c1-2-3-4-11-18(23)20(25)27-14-16-9-5-6-10-17(16)15-28-21(26)19(24)12-7-8-13-22/h5-6,9-10,18-19H,2-4,7-8,11-15,22-24H2,1H3/t18-,19-/m0/s1 |
| InChIKey | DUBPNZYJYIMESS-OALUTQOASA-N |
| XLogP | 3.57 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.66 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|