C15H25N3O2 — CID 156568497
(2S)-2,6-diamino-N-[1-(2-hydroxyphenyl)propan-2-yl]hexanamide (PubChem CID 156568497) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[1-(2-hydroxyphenyl)propan-2-yl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[1-(2-hydroxyphenyl)propan-2-yl]hexanamide |
|---|---|
| PubChem CID | 156568497 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | (2S)-2,6-diamino-N-[1-(2-hydroxyphenyl)propan-2-yl]hexanamide |
| SMILES | CC(Cc1ccccc1O)NC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C15H25N3O2/c1-11(10-12-6-2-3-8-14(12)19)18-15(20)13(17)7-4-5-9-16/h2-3,6,8,11,13,19H,4-5,7,9-10,16-17H2,1H3,(H,18,20)/t11?,13-/m0/s1 |
| InChIKey | WXGDFJXLLLBGGD-YUZLPWPTSA-N |
| XLogP | 0.90 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|