C12H19N3O2 — CID 172827982
(2S)-2,6-diamino-N-(2-hydroxyphenyl)hexanamide (PubChem CID 172827982) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-(2-hydroxyphenyl)hexanamide.
| Compound Name | (2S)-2,6-diamino-N-(2-hydroxyphenyl)hexanamide |
|---|---|
| PubChem CID | 172827982 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | (2S)-2,6-diamino-N-(2-hydroxyphenyl)hexanamide |
| SMILES | NCCCC[C@H](N)C(=O)Nc1ccccc1O |
| InChI | InChI=1S/C12H19N3O2/c13-8-4-3-5-9(14)12(17)15-10-6-1-2-7-11(10)16/h1-2,6-7,9,16H,3-5,8,13-14H2,(H,15,17)/t9-/m0/s1 |
| InChIKey | VDCLSBMPMHGCTO-VIFPVBQESA-N |
| XLogP | 0.79 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|