C12H19N3O3S — CID 67920805
(2S)-2,6-diamino-N-(benzenesulfonyl)hexanamide (PubChem CID 67920805) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-(benzenesulfonyl)hexanamide.
| Compound Name | (2S)-2,6-diamino-N-(benzenesulfonyl)hexanamide |
|---|---|
| PubChem CID | 67920805 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (2S)-2,6-diamino-N-(benzenesulfonyl)hexanamide |
| SMILES | NCCCC[C@H](N)C(=O)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H19N3O3S/c13-9-5-4-8-11(14)12(16)15-19(17,18)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9,13-14H2,(H,15,16)/t11-/m0/s1 |
| InChIKey | FOGZWOCKJNZOFM-NSHDSACASA-N |
| XLogP | -0.05 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|