C13H21N3O3S — CID 18957410
2,6-diamino-N-(benzenesulfonylmethyl)hexanamide (PubChem CID 18957410) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2,6-diamino-N-(benzenesulfonylmethyl)hexanamide.
| Compound Name | 2,6-diamino-N-(benzenesulfonylmethyl)hexanamide |
|---|---|
| PubChem CID | 18957410 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2,6-diamino-N-(benzenesulfonylmethyl)hexanamide |
| SMILES | NCCCCC(N)C(=O)NCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H21N3O3S/c14-9-5-4-8-12(15)13(17)16-10-20(18,19)11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,14-15H2,(H,16,17) |
| InChIKey | TWZDQNIAVLSTKF-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|