C11H19N3OS — CID 70869921
(2S)-2,6-diamino-N-(thiophen-2-ylmethyl)hexanamide (PubChem CID 70869921) has the molecular formula C11H19N3OS and a molecular weight of 241.36 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-(thiophen-2-ylmethyl)hexanamide.
| Compound Name | (2S)-2,6-diamino-N-(thiophen-2-ylmethyl)hexanamide |
|---|---|
| PubChem CID | 70869921 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | (2S)-2,6-diamino-N-(thiophen-2-ylmethyl)hexanamide |
| SMILES | NCCCC[C@H](N)C(=O)NCc1cccs1 |
| InChI | InChI=1S/C11H19N3OS/c12-6-2-1-5-10(13)11(15)14-8-9-4-3-7-16-9/h3-4,7,10H,1-2,5-6,8,12-13H2,(H,14,15)/t10-/m0/s1 |
| InChIKey | XNZJYOARBPONJA-JTQLQIEISA-N |
| XLogP | 0.82 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|