C21H31N3O2S — CID 70294424
(2S)-2-amino-N-[(2S)-6-amino-1-(3,4-dimethylphenoxy)hexan-2-yl]-3-thiophen-2-ylpropanamide (PubChem CID 70294424) has the molecular formula C21H31N3O2S and a molecular weight of 389.57 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-6-amino-1-(3,4-dimethylphenoxy)hexan-2-yl]-3-thiophen-2-ylpropanamide.
| Compound Name | (2S)-2-amino-N-[(2S)-6-amino-1-(3,4-dimethylphenoxy)hexan-2-yl]-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 70294424 |
| Molecular Formula | C21H31N3O2S |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-6-amino-1-(3,4-dimethylphenoxy)hexan-2-yl]-3-thiophen-2-ylpropanamide |
| SMILES | Cc1ccc(OC[C@H](CCCCN)NC(=O)[C@@H](N)Cc2cccs2)cc1C |
| InChI | InChI=1S/C21H31N3O2S/c1-15-8-9-18(12-16(15)2)26-14-17(6-3-4-10-22)24-21(25)20(23)13-19-7-5-11-27-19/h5,7-9,11-12,17,20H,3-4,6,10,13-14,22-23H2,1-2H3,(H,24,25)/t17-,20-/m0/s1 |
| InChIKey | ZUEVEKRWASQGGK-PXNSSMCTSA-N |
| XLogP | 2.93 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|