2-amino-4-[3-(3,4-dimethylphenoxy)propylsulfanyl]butanoic acid

C15H23NO3S — CID 60929016

IUPAC2-amino-4-[3-(3,4-dimethylphenoxy)propylsulfanyl]butanoic acid
SMILESCc1ccc(OCCCSCCC(N)C(=O)O)cc1C
InChIInChI=1S/C15H23NO3S/c1-11-4-5-13(10-12(11)2)19-7-3-8-20-9-6-14(16)15(17)18/h4-5,10,14H,3,6-9,16H2,1-2H3,(H,17,18)
InChIKeyRNHBCKHEDOYHMQ-UHFFFAOYSA-N
MW297.42 g/mol
LogP2.61
Rot. Bonds9

About 2-amino-4-[3-(3,4-dimethylphenoxy)propylsulfanyl]butanoic acid

2-amino-4-[3-(3,4-dimethylphenoxy)propylsulfanyl]butanoic acid (PubChem CID 60929016) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 2-amino-4-[3-(3,4-dimethylphenoxy)propylsulfanyl]butanoic acid.

Molecular Properties

Compound Name2-amino-4-[3-(3,4-dimethylphenoxy)propylsulfanyl]butanoic acid
PubChem CID60929016
Molecular FormulaC15H23NO3S
Molecular Weight297.42 g/mol
Exact Mass297.14
IUPAC Name2-amino-4-[3-(3,4-dimethylphenoxy)propylsulfanyl]butanoic acid
SMILESCc1ccc(OCCCSCCC(N)C(=O)O)cc1C
InChIInChI=1S/C15H23NO3S/c1-11-4-5-13(10-12(11)2)19-7-3-8-20-9-6-14(16)15(17)18/h4-5,10,14H,3,6-9,16H2,1-2H3,(H,17,18)
InChIKeyRNHBCKHEDOYHMQ-UHFFFAOYSA-N
XLogP2.61
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds9
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.42
LogP ≤ 52.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-amino-4-[3-(3,4-dimethylphenoxy)propylsulfanyl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-4-[3-(3,4-dimethylphenoxy)propylsulfanyl]butanoic acid?
The IUPAC name of 2-amino-4-[3-(3,4-dimethylphenoxy)propylsulfanyl]butanoic acid (CID 60929016) is 2-amino-4-[3-(3,4-dimethylphenoxy)propylsulfanyl]butanoic acid.
What is the SMILES notation for 2-amino-4-[3-(3,4-dimethylphenoxy)propylsulfanyl]butanoic acid?
The canonical SMILES for 2-amino-4-[3-(3,4-dimethylphenoxy)propylsulfanyl]butanoic acid is Cc1ccc(OCCCSCCC(N)C(=O)O)cc1C.
What is the InChIKey of 2-amino-4-[3-(3,4-dimethylphenoxy)propylsulfanyl]butanoic acid?
The InChIKey is RNHBCKHEDOYHMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO3S/c1-11-4-5-13(10-12(11)2)19-7-3-8-20-9-6-14(16)15(17)18/h4-5,10,14H,3,6-9,16H2,1-2H3,(H,17,18).
What are the key properties of 2-amino-4-[3-(3,4-dimethylphenoxy)propylsulfanyl]butanoic acid?
2-amino-4-[3-(3,4-dimethylphenoxy)propylsulfanyl]butanoic acid has a molecular weight of 297.42 g/mol, XLogP of 2.61, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-[3-(3,4-dimethylphenoxy)propylsulfanyl]butanoic acid is sourced from PubChem (CID 60929016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).