C15H23NO3S — CID 60929016
2-amino-4-[3-(3,4-dimethylphenoxy)propylsulfanyl]butanoic acid (PubChem CID 60929016) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 2-amino-4-[3-(3,4-dimethylphenoxy)propylsulfanyl]butanoic acid.
| Compound Name | 2-amino-4-[3-(3,4-dimethylphenoxy)propylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 60929016 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-amino-4-[3-(3,4-dimethylphenoxy)propylsulfanyl]butanoic acid |
| SMILES | Cc1ccc(OCCCSCCC(N)C(=O)O)cc1C |
| InChI | InChI=1S/C15H23NO3S/c1-11-4-5-13(10-12(11)2)19-7-3-8-20-9-6-14(16)15(17)18/h4-5,10,14H,3,6-9,16H2,1-2H3,(H,17,18) |
| InChIKey | RNHBCKHEDOYHMQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|