C15H24O2S — CID 66105575
3-[3-(3,4-dimethylphenoxy)propylsulfanyl]-2-methylpropan-1-ol (PubChem CID 66105575) has the molecular formula C15H24O2S and a molecular weight of 268.42 g/mol. Its IUPAC name is 3-[3-(3,4-dimethylphenoxy)propylsulfanyl]-2-methylpropan-1-ol.
| Compound Name | 3-[3-(3,4-dimethylphenoxy)propylsulfanyl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 66105575 |
| Molecular Formula | C15H24O2S |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 3-[3-(3,4-dimethylphenoxy)propylsulfanyl]-2-methylpropan-1-ol |
| SMILES | Cc1ccc(OCCCSCC(C)CO)cc1C |
| InChI | InChI=1S/C15H24O2S/c1-12(10-16)11-18-8-4-7-17-15-6-5-13(2)14(3)9-15/h5-6,9,12,16H,4,7-8,10-11H2,1-3H3 |
| InChIKey | PIJHGTRGOSWTEP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|