C17H21NOS — CID 43249013
2-[3-(3,4-dimethylphenoxy)propylsulfanyl]aniline (PubChem CID 43249013) has the molecular formula C17H21NOS and a molecular weight of 287.43 g/mol. Its IUPAC name is 2-[3-(3,4-dimethylphenoxy)propylsulfanyl]aniline.
| Compound Name | 2-[3-(3,4-dimethylphenoxy)propylsulfanyl]aniline |
|---|---|
| PubChem CID | 43249013 |
| Molecular Formula | C17H21NOS |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-[3-(3,4-dimethylphenoxy)propylsulfanyl]aniline |
| SMILES | Cc1ccc(OCCCSc2ccccc2N)cc1C |
| InChI | InChI=1S/C17H21NOS/c1-13-8-9-15(12-14(13)2)19-10-5-11-20-17-7-4-3-6-16(17)18/h3-4,6-9,12H,5,10-11,18H2,1-2H3 |
| InChIKey | KCJLAJUECAFKTF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|