C17H20ClNOS — CID 79128599
4-chloro-3-[3-(3,4-dimethylphenoxy)propylsulfanyl]aniline (PubChem CID 79128599) has the molecular formula C17H20ClNOS and a molecular weight of 321.87 g/mol. Its IUPAC name is 4-chloro-3-[3-(3,4-dimethylphenoxy)propylsulfanyl]aniline.
| Compound Name | 4-chloro-3-[3-(3,4-dimethylphenoxy)propylsulfanyl]aniline |
|---|---|
| PubChem CID | 79128599 |
| Molecular Formula | C17H20ClNOS |
| Molecular Weight | 321.87 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 4-chloro-3-[3-(3,4-dimethylphenoxy)propylsulfanyl]aniline |
| SMILES | Cc1ccc(OCCCSc2cc(N)ccc2Cl)cc1C |
| InChI | InChI=1S/C17H20ClNOS/c1-12-4-6-15(10-13(12)2)20-8-3-9-21-17-11-14(19)5-7-16(17)18/h4-7,10-11H,3,8-9,19H2,1-2H3 |
| InChIKey | VTFBUXNJWGSQOJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.87 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|