C14H13Cl2NOS — CID 43366280
4-[2-(2,5-dichlorophenyl)sulfanylethoxy]aniline (PubChem CID 43366280) has the molecular formula C14H13Cl2NOS and a molecular weight of 314.24 g/mol. Its IUPAC name is 4-[2-(2,5-dichlorophenyl)sulfanylethoxy]aniline.
| Compound Name | 4-[2-(2,5-dichlorophenyl)sulfanylethoxy]aniline |
|---|---|
| PubChem CID | 43366280 |
| Molecular Formula | C14H13Cl2NOS |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 4-[2-(2,5-dichlorophenyl)sulfanylethoxy]aniline |
| SMILES | Nc1ccc(OCCSc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C14H13Cl2NOS/c15-10-1-6-13(16)14(9-10)19-8-7-18-12-4-2-11(17)3-5-12/h1-6,9H,7-8,17H2 |
| InChIKey | NRXWUJWVCBVACX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|