C15H12Cl2O3S — CID 22683549
3-[2-(2,5-dichlorophenyl)sulfanylethoxy]benzoic acid (PubChem CID 22683549) has the molecular formula C15H12Cl2O3S and a molecular weight of 343.23 g/mol. Its IUPAC name is 3-[2-(2,5-dichlorophenyl)sulfanylethoxy]benzoic acid.
| Compound Name | 3-[2-(2,5-dichlorophenyl)sulfanylethoxy]benzoic acid |
|---|---|
| PubChem CID | 22683549 |
| Molecular Formula | C15H12Cl2O3S |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 3-[2-(2,5-dichlorophenyl)sulfanylethoxy]benzoic acid |
| SMILES | O=C(O)c1cccc(OCCSc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C15H12Cl2O3S/c16-11-4-5-13(17)14(9-11)21-7-6-20-12-3-1-2-10(8-12)15(18)19/h1-5,8-9H,6-7H2,(H,18,19) |
| InChIKey | NMCNLVYCYLQHAA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|