C20H26O2 — CID 2227623
4-[4-(3,4-dimethylphenoxy)butoxy]-1,2-dimethylbenzene (PubChem CID 2227623) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 4-[4-(3,4-dimethylphenoxy)butoxy]-1,2-dimethylbenzene.
| Compound Name | 4-[4-(3,4-dimethylphenoxy)butoxy]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 2227623 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 4-[4-(3,4-dimethylphenoxy)butoxy]-1,2-dimethylbenzene |
| SMILES | Cc1ccc(OCCCCOc2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C20H26O2/c1-15-7-9-19(13-17(15)3)21-11-5-6-12-22-20-10-8-16(2)18(4)14-20/h7-10,13-14H,5-6,11-12H2,1-4H3 |
| InChIKey | NODBLIMSTFFGOD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|