C12H18O3 — CID 61074623
2-[2-(3,4-dimethylphenoxy)ethoxy]ethanol (PubChem CID 61074623) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 2-[2-(3,4-dimethylphenoxy)ethoxy]ethanol.
| Compound Name | 2-[2-(3,4-dimethylphenoxy)ethoxy]ethanol |
|---|---|
| PubChem CID | 61074623 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 2-[2-(3,4-dimethylphenoxy)ethoxy]ethanol |
| SMILES | Cc1ccc(OCCOCCO)cc1C |
| InChI | InChI=1S/C12H18O3/c1-10-3-4-12(9-11(10)2)15-8-7-14-6-5-13/h3-4,9,13H,5-8H2,1-2H3 |
| InChIKey | IPRIPKVVOMWGOW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|