C10H16N2OS2 — CID 22690032
(2S)-2-amino-4-methylsulfanyl-N-(thiophen-2-ylmethyl)butanamide (PubChem CID 22690032) has the molecular formula C10H16N2OS2 and a molecular weight of 244.38 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanyl-N-(thiophen-2-ylmethyl)butanamide.
| Compound Name | (2S)-2-amino-4-methylsulfanyl-N-(thiophen-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 22690032 |
| Molecular Formula | C10H16N2OS2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanyl-N-(thiophen-2-ylmethyl)butanamide |
| SMILES | CSCC[C@H](N)C(=O)NCc1cccs1 |
| InChI | InChI=1S/C10H16N2OS2/c1-14-6-4-9(11)10(13)12-7-8-3-2-5-15-8/h2-3,5,9H,4,6-7,11H2,1H3,(H,12,13)/t9-/m0/s1 |
| InChIKey | PNQHOKFCGUOSMR-VIFPVBQESA-N |
| XLogP | 1.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |