C12H18N2O3S2 — CID 61179534
3-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-thiophen-2-ylpropanoic acid (PubChem CID 61179534) has the molecular formula C12H18N2O3S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 3-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-thiophen-2-ylpropanoic acid.
| Compound Name | 3-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 61179534 |
| Molecular Formula | C12H18N2O3S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 3-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-thiophen-2-ylpropanoic acid |
| SMILES | CSCC[C@H](N)C(=O)NC(CC(=O)O)c1cccs1 |
| InChI | InChI=1S/C12H18N2O3S2/c1-18-6-4-8(13)12(17)14-9(7-11(15)16)10-3-2-5-19-10/h2-3,5,8-9H,4,6-7,13H2,1H3,(H,14,17)(H,15,16)/t8-,9?/m0/s1 |
| InChIKey | WZUWSELMVPSVIK-IENPIDJESA-N |
| XLogP | 1.46 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |