C10H16N2O2S — CID 104909117
(2R)-2-amino-N-(furan-3-ylmethyl)-4-methylsulfanylbutanamide (PubChem CID 104909117) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is (2R)-2-amino-N-(furan-3-ylmethyl)-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-amino-N-(furan-3-ylmethyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 104909117 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | (2R)-2-amino-N-(furan-3-ylmethyl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@@H](N)C(=O)NCc1ccoc1 |
| InChI | InChI=1S/C10H16N2O2S/c1-15-5-3-9(11)10(13)12-6-8-2-4-14-7-8/h2,4,7,9H,3,5-6,11H2,1H3,(H,12,13)/t9-/m1/s1 |
| InChIKey | XHDDYXZYTCVUJU-SECBINFHSA-N |
| XLogP | 0.98 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |