C12H19ClN4O — CID 90860772
2,6-diamino-N-[(6-chloro-3-pyridinyl)methyl]hexanamide (PubChem CID 90860772) has the molecular formula C12H19ClN4O and a molecular weight of 270.76 g/mol. Its IUPAC name is 2,6-diamino-N-[(6-chloro-3-pyridinyl)methyl]hexanamide.
| Compound Name | 2,6-diamino-N-[(6-chloro-3-pyridinyl)methyl]hexanamide |
|---|---|
| PubChem CID | 90860772 |
| Molecular Formula | C12H19ClN4O |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2,6-diamino-N-[(6-chloro-3-pyridinyl)methyl]hexanamide |
| SMILES | NCCCCC(N)C(=O)NCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C12H19ClN4O/c13-11-5-4-9(7-16-11)8-17-12(18)10(15)3-1-2-6-14/h4-5,7,10H,1-3,6,8,14-15H2,(H,17,18) |
| InChIKey | OZFGCHCDRDHBRC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|