C13H19N3O5S — CID 110839428
4-amino-5-[[4-(2-aminoethyl)phenyl]sulfonylamino]-5-oxopentanoic acid (PubChem CID 110839428) has the molecular formula C13H19N3O5S and a molecular weight of 329.38 g/mol. Its IUPAC name is 4-amino-5-[[4-(2-aminoethyl)phenyl]sulfonylamino]-5-oxopentanoic acid.
| Compound Name | 4-amino-5-[[4-(2-aminoethyl)phenyl]sulfonylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 110839428 |
| Molecular Formula | C13H19N3O5S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 4-amino-5-[[4-(2-aminoethyl)phenyl]sulfonylamino]-5-oxopentanoic acid |
| SMILES | NCCc1ccc(S(=O)(=O)NC(=O)C(N)CCC(=O)O)cc1 |
| InChI | InChI=1S/C13H19N3O5S/c14-8-7-9-1-3-10(4-2-9)22(20,21)16-13(19)11(15)5-6-12(17)18/h1-4,11H,5-8,14-15H2,(H,16,19)(H,17,18) |
| InChIKey | PYULJRVDKZWHNT-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 152.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |