C10H11Cl3N2O3S — CID 110839455
N-[4-(2-aminoethyl)phenyl]sulfonyl-2,2,2-trichloroacetamide (PubChem CID 110839455) has the molecular formula C10H11Cl3N2O3S and a molecular weight of 345.64 g/mol. Its IUPAC name is N-[4-(2-aminoethyl)phenyl]sulfonyl-2,2,2-trichloroacetamide.
| Compound Name | N-[4-(2-aminoethyl)phenyl]sulfonyl-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 110839455 |
| Molecular Formula | C10H11Cl3N2O3S |
| Molecular Weight | 345.64 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | N-[4-(2-aminoethyl)phenyl]sulfonyl-2,2,2-trichloroacetamide |
| SMILES | NCCc1ccc(S(=O)(=O)NC(=O)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C10H11Cl3N2O3S/c11-10(12,13)9(16)15-19(17,18)8-3-1-7(2-4-8)5-6-14/h1-4H,5-6,14H2,(H,15,16) |
| InChIKey | HFMGWWUOMJLFRD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.64 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|