C14H22N2O5 — CID 3045698
(2S)-2-aminopentanedioic acid;2-(4-methoxyphenyl)ethanamine (PubChem CID 3045698) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is (2S)-2-aminopentanedioic acid;2-(4-methoxyphenyl)ethanamine.
| Compound Name | (2S)-2-aminopentanedioic acid;2-(4-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 3045698 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | (2S)-2-aminopentanedioic acid;2-(4-methoxyphenyl)ethanamine |
| SMILES | COc1ccc(CCN)cc1.N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H13NO.C5H9NO4/c1-11-9-4-2-8(3-5-9)6-7-10;6-3(5(9)10)1-2-4(7)8/h2-5H,6-7,10H2,1H3;3H,1-2,6H2,(H,7,8)(H,9,10)/t;3-/m.0/s1 |
| InChIKey | JYZHTUKGXSBYRD-HVDRVSQOSA-N |
| XLogP | 0.46 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |