C16H23NO5 — CID 153255398
(2S)-2-amino-8-[(4-methoxyphenyl)methoxy]-8-oxooctanoic acid (PubChem CID 153255398) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is (2S)-2-amino-8-[(4-methoxyphenyl)methoxy]-8-oxooctanoic acid.
| Compound Name | (2S)-2-amino-8-[(4-methoxyphenyl)methoxy]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 153255398 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | (2S)-2-amino-8-[(4-methoxyphenyl)methoxy]-8-oxooctanoic acid |
| SMILES | COc1ccc(COC(=O)CCCCC[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C16H23NO5/c1-21-13-9-7-12(8-10-13)11-22-15(18)6-4-2-3-5-14(17)16(19)20/h7-10,14H,2-6,11,17H2,1H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | WUDUOLONUPLJJK-AWEZNQCLSA-N |
| XLogP | 2.10 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|