About bis[(4-methoxyphenyl)methyl] 2-aminopentanedioate;hydrochloride
bis[(4-methoxyphenyl)methyl] 2-aminopentanedioate;hydrochloride (PubChem CID 155891056) has the molecular formula C21H26ClNO6
and a molecular weight of 423.89 g/mol. Its IUPAC name is bis[(4-methoxyphenyl)methyl] 2-aminopentanedioate;hydrochloride.
Molecular Properties
| Compound Name | bis[(4-methoxyphenyl)methyl] 2-aminopentanedioate;hydrochloride |
| PubChem CID | 155891056 |
| Molecular Formula | C21H26ClNO6 |
| Molecular Weight | 423.89 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | bis[(4-methoxyphenyl)methyl] 2-aminopentanedioate;hydrochloride |
| SMILES | COc1ccc(COC(=O)CCC(N)C(=O)OCc2ccc(OC)cc2)cc1.Cl |
| InChI | InChI=1S/C21H25NO6.ClH/c1-25-17-7-3-15(4-8-17)13-27-20(23)12-11-19(22)21(24)28-14-16-5-9-18(26-2)10-6-16;/h3-10,19H,11-14,22H2,1-2H3;1H |
| InChIKey | HNAVMOKVZFMXTN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.89 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze bis[(4-methoxyphenyl)methyl] 2-aminopentanedioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(4-methoxyphenyl)methyl] 2-aminopentanedioate;hydrochloride?
The IUPAC name of bis[(4-methoxyphenyl)methyl] 2-aminopentanedioate;hydrochloride (CID 155891056) is bis[(4-methoxyphenyl)methyl] 2-aminopentanedioate;hydrochloride.
What is the SMILES notation for bis[(4-methoxyphenyl)methyl] 2-aminopentanedioate;hydrochloride?
The canonical SMILES for bis[(4-methoxyphenyl)methyl] 2-aminopentanedioate;hydrochloride is COc1ccc(COC(=O)CCC(N)C(=O)OCc2ccc(OC)cc2)cc1.Cl.
What is the InChIKey of bis[(4-methoxyphenyl)methyl] 2-aminopentanedioate;hydrochloride?
The InChIKey is HNAVMOKVZFMXTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO6.ClH/c1-25-17-7-3-15(4-8-17)13-27-20(23)12-11-19(22)21(24)28-14-16-5-9-18(26-2)10-6-16;/h3-10,19H,11-14,22H2,1-2H3;1H.
What are the key properties of bis[(4-methoxyphenyl)methyl] 2-aminopentanedioate;hydrochloride?
bis[(4-methoxyphenyl)methyl] 2-aminopentanedioate;hydrochloride has a molecular weight of 423.89 g/mol, XLogP of 3.02, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(4-methoxyphenyl)methyl] 2-aminopentanedioate;hydrochloride is sourced from PubChem (CID 155891056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).