C13H19NO3S — CID 61302709
(4-methoxyphenyl)methyl 2-amino-4-methylsulfanylbutanoate (PubChem CID 61302709) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2-amino-4-methylsulfanylbutanoate.
| Compound Name | (4-methoxyphenyl)methyl 2-amino-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 61302709 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (4-methoxyphenyl)methyl 2-amino-4-methylsulfanylbutanoate |
| SMILES | COc1ccc(COC(=O)C(N)CCSC)cc1 |
| InChI | InChI=1S/C13H19NO3S/c1-16-11-5-3-10(4-6-11)9-17-13(15)12(14)7-8-18-2/h3-6,12H,7-9,14H2,1-2H3 |
| InChIKey | BPUUBBSBIQZWJL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |