C18H28N2O2S — CID 119313281
(2S)-2-amino-1-[4-[(4-methoxyphenyl)methyl]piperidin-1-yl]-4-methylsulfanylbutan-1-one (PubChem CID 119313281) has the molecular formula C18H28N2O2S and a molecular weight of 336.50 g/mol. Its IUPAC name is (2S)-2-amino-1-[4-[(4-methoxyphenyl)methyl]piperidin-1-yl]-4-methylsulfanylbutan-1-one.
| Compound Name | (2S)-2-amino-1-[4-[(4-methoxyphenyl)methyl]piperidin-1-yl]-4-methylsulfanylbutan-1-one |
|---|---|
| PubChem CID | 119313281 |
| Molecular Formula | C18H28N2O2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (2S)-2-amino-1-[4-[(4-methoxyphenyl)methyl]piperidin-1-yl]-4-methylsulfanylbutan-1-one |
| SMILES | COc1ccc(CC2CCN(C(=O)[C@@H](N)CCSC)CC2)cc1 |
| InChI | InChI=1S/C18H28N2O2S/c1-22-16-5-3-14(4-6-16)13-15-7-10-20(11-8-15)18(21)17(19)9-12-23-2/h3-6,15,17H,7-13,19H2,1-2H3/t17-/m0/s1 |
| InChIKey | VTUNGFJRLACIHZ-KRWDZBQOSA-N |
| XLogP | 2.56 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |