C12H16ClNO2S — CID 104909732
(3-chlorophenyl)methyl (2R)-2-amino-4-methylsulfanylbutanoate (PubChem CID 104909732) has the molecular formula C12H16ClNO2S and a molecular weight of 273.78 g/mol. Its IUPAC name is (3-chlorophenyl)methyl (2R)-2-amino-4-methylsulfanylbutanoate.
| Compound Name | (3-chlorophenyl)methyl (2R)-2-amino-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 104909732 |
| Molecular Formula | C12H16ClNO2S |
| Molecular Weight | 273.78 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | (3-chlorophenyl)methyl (2R)-2-amino-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@@H](N)C(=O)OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H16ClNO2S/c1-17-6-5-11(14)12(15)16-8-9-3-2-4-10(13)7-9/h2-4,7,11H,5-6,8,14H2,1H3/t11-/m1/s1 |
| InChIKey | KMGJQZDSNYMGHD-LLVKDONJSA-N |
| XLogP | 2.46 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.78 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |