About 5-O-[(4-methoxyphenyl)methyl] 1-O-prop-2-enyl 2-hydroxypentanedioate
5-O-[(4-methoxyphenyl)methyl] 1-O-prop-2-enyl 2-hydroxypentanedioate (PubChem CID 69143601) has the molecular formula C16H20O6
and a molecular weight of 308.33 g/mol. Its IUPAC name is 5-O-[(4-methoxyphenyl)methyl] 1-O-prop-2-enyl 2-hydroxypentanedioate.
Molecular Properties
| Compound Name | 5-O-[(4-methoxyphenyl)methyl] 1-O-prop-2-enyl 2-hydroxypentanedioate |
| PubChem CID | 69143601 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 5-O-[(4-methoxyphenyl)methyl] 1-O-prop-2-enyl 2-hydroxypentanedioate |
| SMILES | C=CCOC(=O)C(O)CCC(=O)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C16H20O6/c1-3-10-21-16(19)14(17)8-9-15(18)22-11-12-4-6-13(20-2)7-5-12/h3-7,14,17H,1,8-11H2,2H3 |
| InChIKey | JEPKBNKXRUBNEK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-O-[(4-methoxyphenyl)methyl] 1-O-prop-2-enyl 2-hydroxypentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-[(4-methoxyphenyl)methyl] 1-O-prop-2-enyl 2-hydroxypentanedioate?
The IUPAC name of 5-O-[(4-methoxyphenyl)methyl] 1-O-prop-2-enyl 2-hydroxypentanedioate (CID 69143601) is 5-O-[(4-methoxyphenyl)methyl] 1-O-prop-2-enyl 2-hydroxypentanedioate.
What is the SMILES notation for 5-O-[(4-methoxyphenyl)methyl] 1-O-prop-2-enyl 2-hydroxypentanedioate?
The canonical SMILES for 5-O-[(4-methoxyphenyl)methyl] 1-O-prop-2-enyl 2-hydroxypentanedioate is C=CCOC(=O)C(O)CCC(=O)OCc1ccc(OC)cc1.
What is the InChIKey of 5-O-[(4-methoxyphenyl)methyl] 1-O-prop-2-enyl 2-hydroxypentanedioate?
The InChIKey is JEPKBNKXRUBNEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O6/c1-3-10-21-16(19)14(17)8-9-15(18)22-11-12-4-6-13(20-2)7-5-12/h3-7,14,17H,1,8-11H2,2H3.
What are the key properties of 5-O-[(4-methoxyphenyl)methyl] 1-O-prop-2-enyl 2-hydroxypentanedioate?
5-O-[(4-methoxyphenyl)methyl] 1-O-prop-2-enyl 2-hydroxypentanedioate has a molecular weight of 308.33 g/mol, XLogP of 1.61, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-[(4-methoxyphenyl)methyl] 1-O-prop-2-enyl 2-hydroxypentanedioate is sourced from PubChem (CID 69143601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).