C14H17NO4 — CID 67951060
(2S)-2-amino-5-[(4-ethenylphenyl)methoxy]-5-oxopentanoic acid (PubChem CID 67951060) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is (2S)-2-amino-5-[(4-ethenylphenyl)methoxy]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-[(4-ethenylphenyl)methoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 67951060 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (2S)-2-amino-5-[(4-ethenylphenyl)methoxy]-5-oxopentanoic acid |
| SMILES | C=Cc1ccc(COC(=O)CC[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C14H17NO4/c1-2-10-3-5-11(6-4-10)9-19-13(16)8-7-12(15)14(17)18/h2-6,12H,1,7-9,15H2,(H,17,18)/t12-/m0/s1 |
| InChIKey | KVZIMBMOOLHFSN-LBPRGKRZSA-N |
| XLogP | 1.56 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |