C15H15NO5 — CID 123196272
(4-ethenylphenyl)methyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate (PubChem CID 123196272) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is (4-ethenylphenyl)methyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate.
| Compound Name | (4-ethenylphenyl)methyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate |
|---|---|
| PubChem CID | 123196272 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | (4-ethenylphenyl)methyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate |
| SMILES | C=Cc1ccc(COC(=O)CCC2NC(=O)OC2=O)cc1 |
| InChI | InChI=1S/C15H15NO5/c1-2-10-3-5-11(6-4-10)9-20-13(17)8-7-12-14(18)21-15(19)16-12/h2-6,12H,1,7-9H2,(H,16,19) |
| InChIKey | RNFCGTHNPPPWGW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|