C13H15NO4 — CID 102125035
(2S)-2-amino-4-[(4-ethenylphenyl)methoxy]-4-oxobutanoic acid (PubChem CID 102125035) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is (2S)-2-amino-4-[(4-ethenylphenyl)methoxy]-4-oxobutanoic acid.
| Compound Name | (2S)-2-amino-4-[(4-ethenylphenyl)methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 102125035 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (2S)-2-amino-4-[(4-ethenylphenyl)methoxy]-4-oxobutanoic acid |
| SMILES | C=Cc1ccc(COC(=O)C[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C13H15NO4/c1-2-9-3-5-10(6-4-9)8-18-12(15)7-11(14)13(16)17/h2-6,11H,1,7-8,14H2,(H,16,17)/t11-/m0/s1 |
| InChIKey | AOMKXEQEXPMYBV-NSHDSACASA-N |
| XLogP | 1.17 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |