C12H12N2O5 — CID 19091323
benzyl N-[(2,5-dioxo-1,3-oxazolidin-4-yl)methyl]carbamate (PubChem CID 19091323) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is benzyl N-[(2,5-dioxo-1,3-oxazolidin-4-yl)methyl]carbamate.
| Compound Name | benzyl N-[(2,5-dioxo-1,3-oxazolidin-4-yl)methyl]carbamate |
|---|---|
| PubChem CID | 19091323 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | benzyl N-[(2,5-dioxo-1,3-oxazolidin-4-yl)methyl]carbamate |
| SMILES | O=C(NCC1NC(=O)OC1=O)OCc1ccccc1 |
| InChI | InChI=1S/C12H12N2O5/c15-10-9(14-12(17)19-10)6-13-11(16)18-7-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,16)(H,14,17) |
| InChIKey | VCOGURCTJNSGEN-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|