C15H20N2O3 — CID 122390563
benzyl N-[5-[(2S)-3-oxoaziridin-2-yl]pentyl]carbamate (PubChem CID 122390563) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is benzyl N-[5-[(2S)-3-oxoaziridin-2-yl]pentyl]carbamate.
| Compound Name | benzyl N-[5-[(2S)-3-oxoaziridin-2-yl]pentyl]carbamate |
|---|---|
| PubChem CID | 122390563 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | benzyl N-[5-[(2S)-3-oxoaziridin-2-yl]pentyl]carbamate |
| SMILES | O=C(NCCCCC[C@@H]1NC1=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H20N2O3/c18-14-13(17-14)9-5-2-6-10-16-15(19)20-11-12-7-3-1-4-8-12/h1,3-4,7-8,13H,2,5-6,9-11H2,(H,16,19)(H,17,18)/t13-/m0/s1 |
| InChIKey | CDBWQXDTCOOKCF-ZDUSSCGKSA-N |
| XLogP | 1.97 |
| TPSA | 77.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|