C29H38N4O9 — CID 167674288
2-amino-6-(phenylmethoxycarbonylamino)hexanoic acid;benzyl N-[4-(2,5-dioxo-1,3-oxazolidin-4-yl)butyl]carbamate (PubChem CID 167674288) has the molecular formula C29H38N4O9 and a molecular weight of 586.64 g/mol. Its IUPAC name is 2-amino-6-(phenylmethoxycarbonylamino)hexanoic acid;benzyl N-[4-(2,5-dioxo-1,3-oxazolidin-4-yl)butyl]carbamate.
| Compound Name | 2-amino-6-(phenylmethoxycarbonylamino)hexanoic acid;benzyl N-[4-(2,5-dioxo-1,3-oxazolidin-4-yl)butyl]carbamate |
|---|---|
| PubChem CID | 167674288 |
| Molecular Formula | C29H38N4O9 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | 2-amino-6-(phenylmethoxycarbonylamino)hexanoic acid;benzyl N-[4-(2,5-dioxo-1,3-oxazolidin-4-yl)butyl]carbamate |
| SMILES | NC(CCCCNC(=O)OCc1ccccc1)C(=O)O.O=C(NCCCCC1NC(=O)OC1=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H18N2O5.C14H20N2O4/c18-13-12(17-15(20)22-13)8-4-5-9-16-14(19)21-10-11-6-2-1-3-7-11;15-12(13(17)18)8-4-5-9-16-14(19)20-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10H2,(H,16,19)(H,17,20);1-3,6-7,12H,4-5,8-10,15H2,(H,16,19)(H,17,18) |
| InChIKey | UOXJHNWRONWNOZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 195.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|