C25H28N2O9 — CID 159699809
(2S)-2-amino-5-oxo-5-phenylmethoxypentanoic acid;benzyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate (PubChem CID 159699809) has the molecular formula C25H28N2O9 and a molecular weight of 500.50 g/mol. Its IUPAC name is (2S)-2-amino-5-oxo-5-phenylmethoxypentanoic acid;benzyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate.
| Compound Name | (2S)-2-amino-5-oxo-5-phenylmethoxypentanoic acid;benzyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate |
|---|---|
| PubChem CID | 159699809 |
| Molecular Formula | C25H28N2O9 |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | (2S)-2-amino-5-oxo-5-phenylmethoxypentanoic acid;benzyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate |
| SMILES | N[C@@H](CCC(=O)OCc1ccccc1)C(=O)O.O=C(CCC1NC(=O)OC1=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H13NO5.C12H15NO4/c15-11(18-8-9-4-2-1-3-5-9)7-6-10-12(16)19-13(17)14-10;13-10(12(15)16)6-7-11(14)17-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,17);1-5,10H,6-8,13H2,(H,15,16)/t;10-/m.0/s1 |
| InChIKey | MXLZCGPMDDYKPO-CICJTZRQSA-N |
| XLogP | 2.07 |
| TPSA | 171.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|