benzyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate

C13H13NO5 — CID 4868209

IUPACbenzyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate
SMILESO=C(CCC1NC(=O)OC1=O)OCc1ccccc1
InChIInChI=1S/C13H13NO5/c15-11(18-8-9-4-2-1-3-5-9)7-6-10-12(16)19-13(17)14-10/h1-5,10H,6-8H2,(H,14,17)
InChIKeyUGCBVSDSTGUPBC-UHFFFAOYSA-N
MW263.25 g/mol
LogP1.14
Rot. Bonds5

About benzyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate

benzyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate (PubChem CID 4868209) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is benzyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate.

Molecular Properties

Compound Namebenzyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate
PubChem CID4868209
Molecular FormulaC13H13NO5
Molecular Weight263.25 g/mol
Exact Mass263.08
IUPAC Namebenzyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate
SMILESO=C(CCC1NC(=O)OC1=O)OCc1ccccc1
InChIInChI=1S/C13H13NO5/c15-11(18-8-9-4-2-1-3-5-9)7-6-10-12(16)19-13(17)14-10/h1-5,10H,6-8H2,(H,14,17)
InChIKeyUGCBVSDSTGUPBC-UHFFFAOYSA-N
XLogP1.14
TPSA81.70 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.25
LogP ≤ 51.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze benzyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate?
The IUPAC name of benzyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate (CID 4868209) is benzyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate.
What is the SMILES notation for benzyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate?
The canonical SMILES for benzyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate is O=C(CCC1NC(=O)OC1=O)OCc1ccccc1.
What is the InChIKey of benzyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate?
The InChIKey is UGCBVSDSTGUPBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO5/c15-11(18-8-9-4-2-1-3-5-9)7-6-10-12(16)19-13(17)14-10/h1-5,10H,6-8H2,(H,14,17).
What are the key properties of benzyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate?
benzyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate has a molecular weight of 263.25 g/mol, XLogP of 1.14, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-(2,5-dioxo-1,3-oxazolidin-4-yl)propanoate is sourced from PubChem (CID 4868209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).