C21H32N2O3S — CID 135243274
(4-ethenylphenyl)methyl (4S)-4-(butan-2-ylamino)-6-methyl-5-oxo-7-(sulfanylamino)heptanoate (PubChem CID 135243274) has the molecular formula C21H32N2O3S and a molecular weight of 392.57 g/mol. Its IUPAC name is (4-ethenylphenyl)methyl (4S)-4-(butan-2-ylamino)-6-methyl-5-oxo-7-(sulfanylamino)heptanoate.
| Compound Name | (4-ethenylphenyl)methyl (4S)-4-(butan-2-ylamino)-6-methyl-5-oxo-7-(sulfanylamino)heptanoate |
|---|---|
| PubChem CID | 135243274 |
| Molecular Formula | C21H32N2O3S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (4-ethenylphenyl)methyl (4S)-4-(butan-2-ylamino)-6-methyl-5-oxo-7-(sulfanylamino)heptanoate |
| SMILES | C=Cc1ccc(COC(=O)CC[C@H](NC(C)CC)C(=O)C(C)CNS)cc1 |
| InChI | InChI=1S/C21H32N2O3S/c1-5-16(4)23-19(21(25)15(3)13-22-27)11-12-20(24)26-14-18-9-7-17(6-2)8-10-18/h6-10,15-16,19,22-23,27H,2,5,11-14H2,1,3-4H3/t15?,16?,19-/m0/s1 |
| InChIKey | JPWGBSOMOZWRHC-RJYAGPCLSA-N |
| XLogP | 3.55 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|