C20H27NO4S — CID 90882414
(4-ethenylphenyl)methyl 3-(4-acetamido-2-formylpentyl)sulfanylpropanoate (PubChem CID 90882414) has the molecular formula C20H27NO4S and a molecular weight of 377.51 g/mol. Its IUPAC name is (4-ethenylphenyl)methyl 3-(4-acetamido-2-formylpentyl)sulfanylpropanoate.
| Compound Name | (4-ethenylphenyl)methyl 3-(4-acetamido-2-formylpentyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 90882414 |
| Molecular Formula | C20H27NO4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (4-ethenylphenyl)methyl 3-(4-acetamido-2-formylpentyl)sulfanylpropanoate |
| SMILES | C=Cc1ccc(COC(=O)CCSCC(C=O)CC(C)NC(C)=O)cc1 |
| InChI | InChI=1S/C20H27NO4S/c1-4-17-5-7-18(8-6-17)13-25-20(24)9-10-26-14-19(12-22)11-15(2)21-16(3)23/h4-8,12,15,19H,1,9-11,13-14H2,2-3H3,(H,21,23) |
| InChIKey | RGMXYXJCHIXZAE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|