About 2-(4-acetamido-2-amino-2-formylpentyl)sulfanylethyl 4-ethenylbenzoate
2-(4-acetamido-2-amino-2-formylpentyl)sulfanylethyl 4-ethenylbenzoate (PubChem CID 58875495) has the molecular formula C19H26N2O4S
and a molecular weight of 378.49 g/mol. Its IUPAC name is 2-(4-acetamido-2-amino-2-formylpentyl)sulfanylethyl 4-ethenylbenzoate.
Molecular Properties
| Compound Name | 2-(4-acetamido-2-amino-2-formylpentyl)sulfanylethyl 4-ethenylbenzoate |
| PubChem CID | 58875495 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 2-(4-acetamido-2-amino-2-formylpentyl)sulfanylethyl 4-ethenylbenzoate |
| SMILES | C=Cc1ccc(C(=O)OCCSCC(N)(C=O)CC(C)NC(C)=O)cc1 |
| InChI | InChI=1S/C19H26N2O4S/c1-4-16-5-7-17(8-6-16)18(24)25-9-10-26-13-19(20,12-22)11-14(2)21-15(3)23/h4-8,12,14H,1,9-11,13,20H2,2-3H3,(H,21,23) |
| InChIKey | XHKXTARGEGBELV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-acetamido-2-amino-2-formylpentyl)sulfanylethyl 4-ethenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-acetamido-2-amino-2-formylpentyl)sulfanylethyl 4-ethenylbenzoate?
The IUPAC name of 2-(4-acetamido-2-amino-2-formylpentyl)sulfanylethyl 4-ethenylbenzoate (CID 58875495) is 2-(4-acetamido-2-amino-2-formylpentyl)sulfanylethyl 4-ethenylbenzoate.
What is the SMILES notation for 2-(4-acetamido-2-amino-2-formylpentyl)sulfanylethyl 4-ethenylbenzoate?
The canonical SMILES for 2-(4-acetamido-2-amino-2-formylpentyl)sulfanylethyl 4-ethenylbenzoate is C=Cc1ccc(C(=O)OCCSCC(N)(C=O)CC(C)NC(C)=O)cc1.
What is the InChIKey of 2-(4-acetamido-2-amino-2-formylpentyl)sulfanylethyl 4-ethenylbenzoate?
The InChIKey is XHKXTARGEGBELV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O4S/c1-4-16-5-7-17(8-6-16)18(24)25-9-10-26-13-19(20,12-22)11-14(2)21-15(3)23/h4-8,12,14H,1,9-11,13,20H2,2-3H3,(H,21,23).
What are the key properties of 2-(4-acetamido-2-amino-2-formylpentyl)sulfanylethyl 4-ethenylbenzoate?
2-(4-acetamido-2-amino-2-formylpentyl)sulfanylethyl 4-ethenylbenzoate has a molecular weight of 378.49 g/mol, XLogP of 2.03, 11 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-acetamido-2-amino-2-formylpentyl)sulfanylethyl 4-ethenylbenzoate is sourced from PubChem (CID 58875495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).