About [(4R)-4-(4-ethenylbenzoyl)oxypentyl] 4-ethenylbenzoate
[(4R)-4-(4-ethenylbenzoyl)oxypentyl] 4-ethenylbenzoate (PubChem CID 101015957) has the molecular formula C23H24O4
and a molecular weight of 364.44 g/mol. Its IUPAC name is [(4R)-4-(4-ethenylbenzoyl)oxypentyl] 4-ethenylbenzoate.
Molecular Properties
| Compound Name | [(4R)-4-(4-ethenylbenzoyl)oxypentyl] 4-ethenylbenzoate |
| PubChem CID | 101015957 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | [(4R)-4-(4-ethenylbenzoyl)oxypentyl] 4-ethenylbenzoate |
| SMILES | C=Cc1ccc(C(=O)OCCC[C@@H](C)OC(=O)c2ccc(C=C)cc2)cc1 |
| InChI | InChI=1S/C23H24O4/c1-4-18-8-12-20(13-9-18)22(24)26-16-6-7-17(3)27-23(25)21-14-10-19(5-2)11-15-21/h4-5,8-15,17H,1-2,6-7,16H2,3H3/t17-/m1/s1 |
| InChIKey | JNKJETLWXCIPTP-QGZVFWFLSA-N |
| XLogP | 5.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(4R)-4-(4-ethenylbenzoyl)oxypentyl] 4-ethenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R)-4-(4-ethenylbenzoyl)oxypentyl] 4-ethenylbenzoate?
The IUPAC name of [(4R)-4-(4-ethenylbenzoyl)oxypentyl] 4-ethenylbenzoate (CID 101015957) is [(4R)-4-(4-ethenylbenzoyl)oxypentyl] 4-ethenylbenzoate.
What is the SMILES notation for [(4R)-4-(4-ethenylbenzoyl)oxypentyl] 4-ethenylbenzoate?
The canonical SMILES for [(4R)-4-(4-ethenylbenzoyl)oxypentyl] 4-ethenylbenzoate is C=Cc1ccc(C(=O)OCCC[C@@H](C)OC(=O)c2ccc(C=C)cc2)cc1.
What is the InChIKey of [(4R)-4-(4-ethenylbenzoyl)oxypentyl] 4-ethenylbenzoate?
The InChIKey is JNKJETLWXCIPTP-QGZVFWFLSA-N. The full InChI is InChI=1S/C23H24O4/c1-4-18-8-12-20(13-9-18)22(24)26-16-6-7-17(3)27-23(25)21-14-10-19(5-2)11-15-21/h4-5,8-15,17H,1-2,6-7,16H2,3H3/t17-/m1/s1.
What are the key properties of [(4R)-4-(4-ethenylbenzoyl)oxypentyl] 4-ethenylbenzoate?
[(4R)-4-(4-ethenylbenzoyl)oxypentyl] 4-ethenylbenzoate has a molecular weight of 364.44 g/mol, XLogP of 5.16, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R)-4-(4-ethenylbenzoyl)oxypentyl] 4-ethenylbenzoate is sourced from PubChem (CID 101015957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).