C22H22O6 — CID 101349126
[(1S,4S)-4-(4-ethenylbenzoyl)oxy-1,4-dihydroxybutyl] 4-ethenylbenzoate (PubChem CID 101349126) has the molecular formula C22H22O6 and a molecular weight of 382.41 g/mol. Its IUPAC name is [(1S,4S)-4-(4-ethenylbenzoyl)oxy-1,4-dihydroxybutyl] 4-ethenylbenzoate.
| Compound Name | [(1S,4S)-4-(4-ethenylbenzoyl)oxy-1,4-dihydroxybutyl] 4-ethenylbenzoate |
|---|---|
| PubChem CID | 101349126 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | [(1S,4S)-4-(4-ethenylbenzoyl)oxy-1,4-dihydroxybutyl] 4-ethenylbenzoate |
| SMILES | C=Cc1ccc(C(=O)O[C@H](O)CC[C@@H](O)OC(=O)c2ccc(C=C)cc2)cc1 |
| InChI | InChI=1S/C22H22O6/c1-3-15-5-9-17(10-6-15)21(25)27-19(23)13-14-20(24)28-22(26)18-11-7-16(4-2)8-12-18/h3-12,19-20,23-24H,1-2,13-14H2/t19-,20-/m0/s1 |
| InChIKey | SKWMETGBSJNHFJ-PMACEKPBSA-N |
| XLogP | 3.40 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|