About 4-(2-chloroethoxy)butyl 4-ethenylbenzoate
4-(2-chloroethoxy)butyl 4-ethenylbenzoate (PubChem CID 57236268) has the molecular formula C15H19ClO3
and a molecular weight of 282.77 g/mol. Its IUPAC name is 4-(2-chloroethoxy)butyl 4-ethenylbenzoate.
Molecular Properties
| Compound Name | 4-(2-chloroethoxy)butyl 4-ethenylbenzoate |
| PubChem CID | 57236268 |
| Molecular Formula | C15H19ClO3 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-(2-chloroethoxy)butyl 4-ethenylbenzoate |
| SMILES | C=Cc1ccc(C(=O)OCCCCOCCCl)cc1 |
| InChI | InChI=1S/C15H19ClO3/c1-2-13-5-7-14(8-6-13)15(17)19-11-4-3-10-18-12-9-16/h2,5-8H,1,3-4,9-12H2 |
| InChIKey | UVBUDDBXMFZIOC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-chloroethoxy)butyl 4-ethenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloroethoxy)butyl 4-ethenylbenzoate?
The IUPAC name of 4-(2-chloroethoxy)butyl 4-ethenylbenzoate (CID 57236268) is 4-(2-chloroethoxy)butyl 4-ethenylbenzoate.
What is the SMILES notation for 4-(2-chloroethoxy)butyl 4-ethenylbenzoate?
The canonical SMILES for 4-(2-chloroethoxy)butyl 4-ethenylbenzoate is C=Cc1ccc(C(=O)OCCCCOCCCl)cc1.
What is the InChIKey of 4-(2-chloroethoxy)butyl 4-ethenylbenzoate?
The InChIKey is UVBUDDBXMFZIOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19ClO3/c1-2-13-5-7-14(8-6-13)15(17)19-11-4-3-10-18-12-9-16/h2,5-8H,1,3-4,9-12H2.
What are the key properties of 4-(2-chloroethoxy)butyl 4-ethenylbenzoate?
4-(2-chloroethoxy)butyl 4-ethenylbenzoate has a molecular weight of 282.77 g/mol, XLogP of 3.52, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloroethoxy)butyl 4-ethenylbenzoate is sourced from PubChem (CID 57236268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).