C22H22O6 — CID 102486247
6-(4-formylbenzoyl)oxyhexyl 4-formylbenzoate (PubChem CID 102486247) has the molecular formula C22H22O6 and a molecular weight of 382.41 g/mol. Its IUPAC name is 6-(4-formylbenzoyl)oxyhexyl 4-formylbenzoate.
| Compound Name | 6-(4-formylbenzoyl)oxyhexyl 4-formylbenzoate |
|---|---|
| PubChem CID | 102486247 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 6-(4-formylbenzoyl)oxyhexyl 4-formylbenzoate |
| SMILES | O=Cc1ccc(C(=O)OCCCCCCOC(=O)c2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C22H22O6/c23-15-17-5-9-19(10-6-17)21(25)27-13-3-1-2-4-14-28-22(26)20-11-7-18(16-24)8-12-20/h5-12,15-16H,1-4,13-14H2 |
| InChIKey | HREVKKMFSCGWBX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|