C12H14O4 — CID 88931744
4-hydroxybutyl 4-formylbenzoate (PubChem CID 88931744) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is 4-hydroxybutyl 4-formylbenzoate.
| Compound Name | 4-hydroxybutyl 4-formylbenzoate |
|---|---|
| PubChem CID | 88931744 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 4-hydroxybutyl 4-formylbenzoate |
| SMILES | O=Cc1ccc(C(=O)OCCCCO)cc1 |
| InChI | InChI=1S/C12H14O4/c13-7-1-2-8-16-12(15)11-5-3-10(9-14)4-6-11/h3-6,9,13H,1-2,7-8H2 |
| InChIKey | PIIYTVIFKIUEJT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|