About 4-hydroxybutyl pyridine-4-carboxylate
4-hydroxybutyl pyridine-4-carboxylate (PubChem CID 126720845) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is 4-hydroxybutyl pyridine-4-carboxylate.
Molecular Properties
| Compound Name | 4-hydroxybutyl pyridine-4-carboxylate |
| PubChem CID | 126720845 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 4-hydroxybutyl pyridine-4-carboxylate |
| SMILES | O=C(OCCCCO)c1ccncc1 |
| InChI | InChI=1S/C10H13NO3/c12-7-1-2-8-14-10(13)9-3-5-11-6-4-9/h3-6,12H,1-2,7-8H2 |
| InChIKey | MDSNURZXITYAFN-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxybutyl pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybutyl pyridine-4-carboxylate?
The IUPAC name of 4-hydroxybutyl pyridine-4-carboxylate (CID 126720845) is 4-hydroxybutyl pyridine-4-carboxylate.
What is the SMILES notation for 4-hydroxybutyl pyridine-4-carboxylate?
The canonical SMILES for 4-hydroxybutyl pyridine-4-carboxylate is O=C(OCCCCO)c1ccncc1.
What is the InChIKey of 4-hydroxybutyl pyridine-4-carboxylate?
The InChIKey is MDSNURZXITYAFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c12-7-1-2-8-14-10(13)9-3-5-11-6-4-9/h3-6,12H,1-2,7-8H2.
What are the key properties of 4-hydroxybutyl pyridine-4-carboxylate?
4-hydroxybutyl pyridine-4-carboxylate has a molecular weight of 195.22 g/mol, XLogP of 1.01, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybutyl pyridine-4-carboxylate is sourced from PubChem (CID 126720845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).