C17H17NO6 — CID 91123123
[4-(2,5-dihydroxypyrrol-1-yl)oxy-4-oxobutyl] 4-ethenylbenzoate (PubChem CID 91123123) has the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. Its IUPAC name is [4-(2,5-dihydroxypyrrol-1-yl)oxy-4-oxobutyl] 4-ethenylbenzoate.
| Compound Name | [4-(2,5-dihydroxypyrrol-1-yl)oxy-4-oxobutyl] 4-ethenylbenzoate |
|---|---|
| PubChem CID | 91123123 |
| Molecular Formula | C17H17NO6 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | [4-(2,5-dihydroxypyrrol-1-yl)oxy-4-oxobutyl] 4-ethenylbenzoate |
| SMILES | C=Cc1ccc(C(=O)OCCCC(=O)On2c(O)ccc2O)cc1 |
| InChI | InChI=1S/C17H17NO6/c1-2-12-5-7-13(8-6-12)17(22)23-11-3-4-16(21)24-18-14(19)9-10-15(18)20/h2,5-10,19-20H,1,3-4,11H2 |
| InChIKey | PPVDWNWGNCTOFA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|