C12H16N2O5 — CID 91221904
(2,5-dihydroxypyrrol-1-yl) 5-oxo-5-(prop-2-enylamino)pentanoate (PubChem CID 91221904) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 5-oxo-5-(prop-2-enylamino)pentanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 5-oxo-5-(prop-2-enylamino)pentanoate |
|---|---|
| PubChem CID | 91221904 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 5-oxo-5-(prop-2-enylamino)pentanoate |
| SMILES | C=CCNC(=O)CCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C12H16N2O5/c1-2-8-13-9(15)4-3-5-12(18)19-14-10(16)6-7-11(14)17/h2,6-7,16-17H,1,3-5,8H2,(H,13,15) |
| InChIKey | WYNSGUOEJJOOOF-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|