C16H26N6O7 — CID 54319212
(2,5-dihydroxypyrrol-1-yl) 3-[[6-(hydrazinecarbonyl)-7-hydrazinyl-6-methyl-7-oxoheptanoyl]amino]propanoate (PubChem CID 54319212) has the molecular formula C16H26N6O7 and a molecular weight of 414.42 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-[[6-(hydrazinecarbonyl)-7-hydrazinyl-6-methyl-7-oxoheptanoyl]amino]propanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-[[6-(hydrazinecarbonyl)-7-hydrazinyl-6-methyl-7-oxoheptanoyl]amino]propanoate |
|---|---|
| PubChem CID | 54319212 |
| Molecular Formula | C16H26N6O7 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-[[6-(hydrazinecarbonyl)-7-hydrazinyl-6-methyl-7-oxoheptanoyl]amino]propanoate |
| SMILES | CC(CCCCC(=O)NCCC(=O)On1c(O)ccc1O)(C(=O)NN)C(=O)NN |
| InChI | InChI=1S/C16H26N6O7/c1-16(14(27)20-17,15(28)21-18)8-3-2-4-10(23)19-9-7-13(26)29-22-11(24)5-6-12(22)25/h5-6,24-25H,2-4,7-9,17-18H2,1H3,(H,19,23)(H,20,27)(H,21,28) |
| InChIKey | SQKXQESFGXDZJH-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 211.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|