C11H15NO7 — CID 90907971
4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-(2-methoxyethyl) butanedioate (PubChem CID 90907971) has the molecular formula C11H15NO7 and a molecular weight of 273.24 g/mol. Its IUPAC name is 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-(2-methoxyethyl) butanedioate.
| Compound Name | 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-(2-methoxyethyl) butanedioate |
|---|---|
| PubChem CID | 90907971 |
| Molecular Formula | C11H15NO7 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-(2-methoxyethyl) butanedioate |
| SMILES | COCCOC(=O)CCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C11H15NO7/c1-17-6-7-18-10(15)4-5-11(16)19-12-8(13)2-3-9(12)14/h2-3,13-14H,4-7H2,1H3 |
| InChIKey | UURGWKFUOOBCPU-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|