C16H29NO10P2 — CID 91315995
(2,5-dihydroxypyrrol-1-yl) 4,4-bis(diethoxyphosphoryl)butanoate (PubChem CID 91315995) has the molecular formula C16H29NO10P2 and a molecular weight of 457.35 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4,4-bis(diethoxyphosphoryl)butanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4,4-bis(diethoxyphosphoryl)butanoate |
|---|---|
| PubChem CID | 91315995 |
| Molecular Formula | C16H29NO10P2 |
| Molecular Weight | 457.35 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4,4-bis(diethoxyphosphoryl)butanoate |
| SMILES | CCOP(=O)(OCC)C(CCC(=O)On1c(O)ccc1O)P(=O)(OCC)OCC |
| InChI | InChI=1S/C16H29NO10P2/c1-5-23-28(21,24-6-2)16(29(22,25-7-3)26-8-4)12-11-15(20)27-17-13(18)9-10-14(17)19/h9-10,16,18-19H,5-8,11-12H2,1-4H3 |
| InChIKey | AHVXLLRLJADBSB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|